C23H22N4O6S — CID 55509189
[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-[(2-phenylacetyl)amino]propanoate (PubChem CID 55509189) has the molecular formula C23H22N4O6S and a molecular weight of 482.52 g/mol. Its IUPAC name is [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-[(2-phenylacetyl)amino]propanoate.
| Compound Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-[(2-phenylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 55509189 |
| Molecular Formula | C23H22N4O6S |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl] 3-[(2-phenylacetyl)amino]propanoate |
| SMILES | CC(OC(=O)CCNC(=O)Cc1ccccc1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C23H22N4O6S/c1-15(33-21(29)10-11-24-20(28)12-16-6-3-2-4-7-16)22(30)26-23-25-19(14-34-23)17-8-5-9-18(13-17)27(31)32/h2-9,13-15H,10-12H2,1H3,(H,24,28)(H,25,26,30) |
| InChIKey | HTEHVSNJHGYWBM-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 140.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|