C23H19N3O7S — CID 55323505
methyl 4-[(E)-3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]oxy-3-oxoprop-1-enyl]benzoate (PubChem CID 55323505) has the molecular formula C23H19N3O7S and a molecular weight of 481.49 g/mol. Its IUPAC name is methyl 4-[(E)-3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]oxy-3-oxoprop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]oxy-3-oxoprop-1-enyl]benzoate |
|---|---|
| PubChem CID | 55323505 |
| Molecular Formula | C23H19N3O7S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | methyl 4-[(E)-3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]oxy-3-oxoprop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)OC(C)C(=O)Nc2nc(-c3cccc([N+](=O)[O-])c3)cs2)cc1 |
| InChI | InChI=1S/C23H19N3O7S/c1-14(33-20(27)11-8-15-6-9-16(10-7-15)22(29)32-2)21(28)25-23-24-19(13-34-23)17-4-3-5-18(12-17)26(30)31/h3-14H,1-2H3,(H,24,25,28)/b11-8+ |
| InChIKey | VLVXCXUGFMSNCU-DHZHZOJOSA-N |
| XLogP | 4.09 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|