C21H17N3O5S — CID 42965380
[1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(2-nitrophenyl)prop-2-enoate (PubChem CID 42965380) has the molecular formula C21H17N3O5S and a molecular weight of 423.45 g/mol. Its IUPAC name is [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(2-nitrophenyl)prop-2-enoate.
| Compound Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 42965380 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | [1-oxo-1-[(4-phenyl-1,3-thiazol-2-yl)amino]propan-2-yl] (E)-3-(2-nitrophenyl)prop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccccc1[N+](=O)[O-])C(=O)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H17N3O5S/c1-14(29-19(25)12-11-16-9-5-6-10-18(16)24(27)28)20(26)23-21-22-17(13-30-21)15-7-3-2-4-8-15/h2-14H,1H3,(H,22,23,26)/b12-11+ |
| InChIKey | BNUWZLNOFOHKCP-VAWYXSNFSA-N |
| XLogP | 4.30 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|