C18H13N3O3S — CID 1304786
3-(2-nitrophenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 1304786) has the molecular formula C18H13N3O3S and a molecular weight of 351.39 g/mol. Its IUPAC name is 3-(2-nitrophenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | 3-(2-nitrophenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1304786 |
| Molecular Formula | C18H13N3O3S |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.07 |
| IUPAC Name | 3-(2-nitrophenyl)-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1[N+](=O)[O-])Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H13N3O3S/c22-17(11-10-14-8-4-5-9-16(14)21(23)24)20-18-19-15(12-25-18)13-6-2-1-3-7-13/h1-12H,(H,19,20,22) |
| InChIKey | YBFIVYFFIXFMSJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|