C19H13F2N3O4S — CID 1347731
(E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 1347731) has the molecular formula C19H13F2N3O4S and a molecular weight of 417.39 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 1347731 |
| Molecular Formula | C19H13F2N3O4S |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-5-nitrophenyl]-N-(4-phenyl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc([N+](=O)[O-])ccc1OC(F)F)Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C19H13F2N3O4S/c20-18(21)28-16-8-7-14(24(26)27)10-13(16)6-9-17(25)23-19-22-15(11-29-19)12-4-2-1-3-5-12/h1-11,18H,(H,22,23,25)/b9-6+ |
| InChIKey | IHFRRMHIESDHBT-RMKNXTFCSA-N |
| XLogP | 4.97 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|