C19H12N4O3S — CID 8780770
(E)-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 8780770) has the molecular formula C19H12N4O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is (E)-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8780770 |
| Molecular Formula | C19H12N4O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | (E)-N-[4-(4-cyanophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | N#Cc1ccc(-c2csc(NC(=O)/C=C/c3cccc([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C19H12N4O3S/c20-11-14-4-7-15(8-5-14)17-12-27-19(21-17)22-18(24)9-6-13-2-1-3-16(10-13)23(25)26/h1-10,12H,(H,21,22,24)/b9-6+ |
| InChIKey | HXVSWSDPPKAYGP-RMKNXTFCSA-N |
| XLogP | 4.24 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|