C18H12BrN3O3S — CID 2240886
(E)-N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 2240886) has the molecular formula C18H12BrN3O3S and a molecular weight of 430.28 g/mol. Its IUPAC name is (E)-N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2240886 |
| Molecular Formula | C18H12BrN3O3S |
| Molecular Weight | 430.28 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | (E)-N-[4-(3-bromophenyl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1nc(-c2cccc(Br)c2)cs1 |
| InChI | InChI=1S/C18H12BrN3O3S/c19-14-5-2-4-13(10-14)16-11-26-18(20-16)21-17(23)8-7-12-3-1-6-15(9-12)22(24)25/h1-11H,(H,20,21,23)/b8-7+ |
| InChIKey | CNYDLZOSPVASJW-BQYQJAHWSA-N |
| XLogP | 5.13 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.28 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|