C19H12N4O3S2 — CID 4617058
N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 4617058) has the molecular formula C19H12N4O3S2 and a molecular weight of 408.46 g/mol. Its IUPAC name is N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4617058 |
| Molecular Formula | C19H12N4O3S2 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | N-[4-(1,3-benzothiazol-2-yl)-1,3-thiazol-2-yl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)Nc1nc(-c2nc3ccccc3s2)cs1 |
| InChI | InChI=1S/C19H12N4O3S2/c24-17(9-8-12-4-3-5-13(10-12)23(25)26)22-19-21-15(11-27-19)18-20-14-6-1-2-7-16(14)28-18/h1-11H,(H,21,22,24) |
| InChIKey | LVMPOWHPKITABY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|