C24H18N4O3S2 — CID 2217476
(E)-N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 2217476) has the molecular formula C24H18N4O3S2 and a molecular weight of 474.57 g/mol. Its IUPAC name is (E)-N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2217476 |
| Molecular Formula | C24H18N4O3S2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | (E)-N-[[3-(1,3-benzothiazol-2-yl)-2-methylphenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1c(NC(=S)NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)cccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H18N4O3S2/c1-15-18(23-25-20-9-2-3-11-21(20)33-23)8-5-10-19(15)26-24(32)27-22(29)13-12-16-6-4-7-17(14-16)28(30)31/h2-14H,1H3,(H2,26,27,29,32)/b13-12+ |
| InChIKey | RGMWYGNNZBGPCT-OUKQBFOZSA-N |
| XLogP | 5.71 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|