C16H11Cl2N3O3S — CID 17176230
(E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17176230) has the molecular formula C16H11Cl2N3O3S and a molecular weight of 396.26 g/mol. Its IUPAC name is (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17176230 |
| Molecular Formula | C16H11Cl2N3O3S |
| Molecular Weight | 396.26 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | (E)-N-[(2,3-dichlorophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NC(=S)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H11Cl2N3O3S/c17-12-5-2-6-13(15(12)18)19-16(25)20-14(22)8-7-10-3-1-4-11(9-10)21(23)24/h1-9H,(H2,19,20,22,25)/b8-7+ |
| InChIKey | FBXYRMGZHQDSPO-BQYQJAHWSA-N |
| XLogP | 4.43 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|