C17H11ClF3N3O3S — CID 2904522
N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 2904522) has the molecular formula C17H11ClF3N3O3S and a molecular weight of 429.81 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2904522 |
| Molecular Formula | C17H11ClF3N3O3S |
| Molecular Weight | 429.81 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)NC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H11ClF3N3O3S/c18-13-6-5-11(17(19,20)21)9-14(13)22-16(28)23-15(25)7-4-10-2-1-3-12(8-10)24(26)27/h1-9H,(H2,22,23,25,28) |
| InChIKey | MQNFUMPWQTWNJH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|