C16H11ClN4O5S — CID 17176170
(E)-N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17176170) has the molecular formula C16H11ClN4O5S and a molecular weight of 406.81 g/mol. Its IUPAC name is (E)-N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17176170 |
| Molecular Formula | C16H11ClN4O5S |
| Molecular Weight | 406.81 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (E)-N-[(4-chloro-3-nitrophenyl)carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NC(=S)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11ClN4O5S/c17-13-6-5-11(9-14(13)21(25)26)18-16(27)19-15(22)7-4-10-2-1-3-12(8-10)20(23)24/h1-9H,(H2,18,19,22,27)/b7-4+ |
| InChIKey | MBKLALHJPTXIIF-QPJJXVBHSA-N |
| XLogP | 3.68 |
| TPSA | 127.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.81 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|