C20H18ClN5O4S2 — CID 6171271
(E)-3-(4-chloro-3-nitrophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 6171271) has the molecular formula C20H18ClN5O4S2 and a molecular weight of 491.98 g/mol. Its IUPAC name is (E)-3-(4-chloro-3-nitrophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 6171271 |
| Molecular Formula | C20H18ClN5O4S2 |
| Molecular Weight | 491.98 g/mol |
| Exact Mass | 491.05 |
| IUPAC Name | (E)-3-(4-chloro-3-nitrophenyl)-N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)/C=C/c2ccc(Cl)c([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H18ClN5O4S2/c1-2-17(27)24-19(31)22-13-5-7-14(8-6-13)23-20(32)25-18(28)10-4-12-3-9-15(21)16(11-12)26(29)30/h3-11H,2H2,1H3,(H2,22,24,27,31)(H2,23,25,28,32)/b10-4+ |
| InChIKey | AWMHPFFHYBQBMU-ONNFQVAWSA-N |
| XLogP | 4.00 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.98 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|