C21H22ClN3O5 — CID 4995639
N-[4-[3-(4-chloro-3-nitrophenyl)prop-2-enoylamino]-2-methoxyphenyl]pentanamide (PubChem CID 4995639) has the molecular formula C21H22ClN3O5 and a molecular weight of 431.88 g/mol. Its IUPAC name is N-[4-[3-(4-chloro-3-nitrophenyl)prop-2-enoylamino]-2-methoxyphenyl]pentanamide.
| Compound Name | N-[4-[3-(4-chloro-3-nitrophenyl)prop-2-enoylamino]-2-methoxyphenyl]pentanamide |
|---|---|
| PubChem CID | 4995639 |
| Molecular Formula | C21H22ClN3O5 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | N-[4-[3-(4-chloro-3-nitrophenyl)prop-2-enoylamino]-2-methoxyphenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(NC(=O)C=Cc2ccc(Cl)c([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C21H22ClN3O5/c1-3-4-5-20(26)24-17-10-8-15(13-19(17)30-2)23-21(27)11-7-14-6-9-16(22)18(12-14)25(28)29/h6-13H,3-5H2,1-2H3,(H,23,27)(H,24,26) |
| InChIKey | KUDVRORNVUQCNH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|