C16H10Cl2N2O5 — CID 28677711
2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 28677711) has the molecular formula C16H10Cl2N2O5 and a molecular weight of 381.17 g/mol. Its IUPAC name is 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 28677711 |
| Molecular Formula | C16H10Cl2N2O5 |
| Molecular Weight | 381.17 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H10Cl2N2O5/c17-12-5-3-10(8-11(12)16(22)23)19-15(21)6-2-9-1-4-13(18)14(7-9)20(24)25/h1-8H,(H,19,21)(H,22,23)/b6-2+ |
| InChIKey | FOTASOAJSPUIMO-QHHAFSJGSA-N |
| XLogP | 4.25 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.17 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|