C17H11Cl2N3O5S — CID 6133102
2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid (PubChem CID 6133102) has the molecular formula C17H11Cl2N3O5S and a molecular weight of 440.26 g/mol. Its IUPAC name is 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 6133102 |
| Molecular Formula | C17H11Cl2N3O5S |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 2-chloro-5-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)NC(=S)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H11Cl2N3O5S/c18-12-5-3-10(8-11(12)16(24)25)20-17(28)21-15(23)6-2-9-1-4-13(19)14(7-9)22(26)27/h1-8H,(H,24,25)(H2,20,21,23,28)/b6-2+ |
| InChIKey | FHLDBVRKSMFFQM-QHHAFSJGSA-N |
| XLogP | 4.13 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|