C17H12ClN3O5S — CID 6133623
2-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid (PubChem CID 6133623) has the molecular formula C17H12ClN3O5S and a molecular weight of 405.82 g/mol. Its IUPAC name is 2-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid.
| Compound Name | 2-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
|---|---|
| PubChem CID | 6133623 |
| Molecular Formula | C17H12ClN3O5S |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-[[(E)-3-(4-chloro-3-nitrophenyl)prop-2-enoyl]carbamothioylamino]benzoic acid |
| SMILES | O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)NC(=S)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C17H12ClN3O5S/c18-12-7-5-10(9-14(12)21(25)26)6-8-15(22)20-17(27)19-13-4-2-1-3-11(13)16(23)24/h1-9H,(H,23,24)(H2,19,20,22,27)/b8-6+ |
| InChIKey | OJVAARWJKICHCB-SOFGYWHQSA-N |
| XLogP | 3.47 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|