C17H13N5O4S — CID 4155009
3-(3-nitrophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide (PubChem CID 4155009) has the molecular formula C17H13N5O4S and a molecular weight of 383.39 g/mol. Its IUPAC name is 3-(3-nitrophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide.
| Compound Name | 3-(3-nitrophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 4155009 |
| Molecular Formula | C17H13N5O4S |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 3-(3-nitrophenyl)-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cccc([N+](=O)[O-])c1)NC(=S)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H13N5O4S/c23-15(7-4-10-2-1-3-12(8-10)22(25)26)21-17(27)18-11-5-6-13-14(9-11)20-16(24)19-13/h1-9H,(H2,19,20,24)(H2,18,21,23,27) |
| InChIKey | ZQUUFLXWRMEPPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|