C18H11ClN4O5S — CID 3521087
3-(4-chloro-3-nitrophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3521087) has the molecular formula C18H11ClN4O5S and a molecular weight of 430.83 g/mol. Its IUPAC name is 3-(4-chloro-3-nitrophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(4-chloro-3-nitrophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3521087 |
| Molecular Formula | C18H11ClN4O5S |
| Molecular Weight | 430.83 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 3-(4-chloro-3-nitrophenyl)-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)c([N+](=O)[O-])c1)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C18H11ClN4O5S/c19-14-6-4-11(8-16(14)23(27)28)5-7-17(24)21-18-20-15(10-29-18)12-2-1-3-13(9-12)22(25)26/h1-10H,(H,20,21,24) |
| InChIKey | JCLWMGXEMQBNHY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.83 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|