C19H12ClN3O5S — CID 16547036
(E)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide (PubChem CID 16547036) has the molecular formula C19H12ClN3O5S and a molecular weight of 429.84 g/mol. Its IUPAC name is (E)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16547036 |
| Molecular Formula | C19H12ClN3O5S |
| Molecular Weight | 429.84 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | (E)-N-[4-(1,3-benzodioxol-5-yl)-1,3-thiazol-2-yl]-3-(4-chloro-3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c([N+](=O)[O-])c1)Nc1nc(-c2ccc3c(c2)OCO3)cs1 |
| InChI | InChI=1S/C19H12ClN3O5S/c20-13-4-1-11(7-15(13)23(25)26)2-6-18(24)22-19-21-14(9-29-19)12-3-5-16-17(8-12)28-10-27-16/h1-9H,10H2,(H,21,22,24)/b6-2+ |
| InChIKey | CHSDIPNIEPUGSG-QHHAFSJGSA-N |
| XLogP | 4.75 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.84 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|