C16H11ClN2O5 — CID 19168176
(E)-3-(1,3-benzodioxol-5-yl)-N-(4-chloro-2-nitrophenyl)prop-2-enamide (PubChem CID 19168176) has the molecular formula C16H11ClN2O5 and a molecular weight of 346.73 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-(4-chloro-2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-chloro-2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 19168176 |
| Molecular Formula | C16H11ClN2O5 |
| Molecular Weight | 346.73 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-(4-chloro-2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H11ClN2O5/c17-11-3-4-12(13(8-11)19(21)22)18-16(20)6-2-10-1-5-14-15(7-10)24-9-23-14/h1-8H,9H2,(H,18,20)/b6-2+ |
| InChIKey | SEVKHLGYGZXHOT-QHHAFSJGSA-N |
| XLogP | 3.63 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.73 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|