C16H10Cl3NO3 — CID 30450464
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 30450464) has the molecular formula C16H10Cl3NO3 and a molecular weight of 370.62 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 30450464 |
| Molecular Formula | C16H10Cl3NO3 |
| Molecular Weight | 370.62 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10Cl3NO3/c17-10-2-3-13(11(18)7-10)20-15(21)4-1-9-5-12(19)16-14(6-9)22-8-23-16/h1-7H,8H2,(H,20,21)/b4-1+ |
| InChIKey | XMTWNPAUIFLQJA-DAFODLJHSA-N |
| XLogP | 5.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.62 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|