C13H10ClNO3 — CID 47110854
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-prop-2-ynylprop-2-enamide (PubChem CID 47110854) has the molecular formula C13H10ClNO3 and a molecular weight of 263.68 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-prop-2-ynylprop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-prop-2-ynylprop-2-enamide |
|---|---|
| PubChem CID | 47110854 |
| Molecular Formula | C13H10ClNO3 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-prop-2-ynylprop-2-enamide |
| SMILES | C#CCNC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C13H10ClNO3/c1-2-5-15-12(16)4-3-9-6-10(14)13-11(7-9)17-8-18-13/h1,3-4,6-7H,5,8H2,(H,15,16)/b4-3+ |
| InChIKey | WUVDIKXQPKTDNP-ONEGZZNKSA-N |
| XLogP | 1.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|