C16H14ClNO3S — CID 43030249
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-thiophen-2-ylethyl)prop-2-enamide (PubChem CID 43030249) has the molecular formula C16H14ClNO3S and a molecular weight of 335.81 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-thiophen-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-thiophen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43030249 |
| Molecular Formula | C16H14ClNO3S |
| Molecular Weight | 335.81 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-(2-thiophen-2-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NCCc1cccs1 |
| InChI | InChI=1S/C16H14ClNO3S/c17-13-8-11(9-14-16(13)21-10-20-14)3-4-15(19)18-6-5-12-2-1-7-22-12/h1-4,7-9H,5-6,10H2,(H,18,19)/b4-3+ |
| InChIKey | OIILGMPMAZXRJE-ONEGZZNKSA-N |
| XLogP | 3.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.81 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|