C17H14ClNO4 — CID 9227583
(E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-phenylmethoxyprop-2-enamide (PubChem CID 9227583) has the molecular formula C17H14ClNO4 and a molecular weight of 331.75 g/mol. Its IUPAC name is (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-phenylmethoxyprop-2-enamide.
| Compound Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-phenylmethoxyprop-2-enamide |
|---|---|
| PubChem CID | 9227583 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | (E)-3-(7-chloro-1,3-benzodioxol-5-yl)-N-phenylmethoxyprop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCO2)NOCc1ccccc1 |
| InChI | InChI=1S/C17H14ClNO4/c18-14-8-13(9-15-17(14)22-11-21-15)6-7-16(20)19-23-10-12-4-2-1-3-5-12/h1-9H,10-11H2,(H,19,20)/b7-6+ |
| InChIKey | HLWJIXLMKDAEAG-VOTSOKGWSA-N |
| XLogP | 3.33 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|