C17H13ClN2O7 — CID 8661014
[2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8661014) has the molecular formula C17H13ClN2O7 and a molecular weight of 392.75 g/mol. Its IUPAC name is [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8661014 |
| Molecular Formula | C17H13ClN2O7 |
| Molecular Weight | 392.75 g/mol |
| Exact Mass | 392.04 |
| IUPAC Name | [2-[2-(furan-2-carbonyl)hydrazinyl]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C17H13ClN2O7/c18-11-6-10(7-13-16(11)27-9-26-13)3-4-15(22)25-8-14(21)19-20-17(23)12-2-1-5-24-12/h1-7H,8-9H2,(H,19,21)(H,20,23)/b4-3+ |
| InChIKey | AMQCGIDYGHHIMV-ONEGZZNKSA-N |
| XLogP | 1.68 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.75 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|