C14H13ClN2O6 — CID 8632956
[2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8632956) has the molecular formula C14H13ClN2O6 and a molecular weight of 340.72 g/mol. Its IUPAC name is [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8632956 |
| Molecular Formula | C14H13ClN2O6 |
| Molecular Weight | 340.72 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [2-[(2-amino-2-oxoethyl)amino]-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | NC(=O)CNC(=O)COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C14H13ClN2O6/c15-9-3-8(4-10-14(9)23-7-22-10)1-2-13(20)21-6-12(19)17-5-11(16)18/h1-4H,5-7H2,(H2,16,18)(H,17,19)/b2-1+ |
| InChIKey | SSGPENAWDKGBSQ-OWOJBTEDSA-N |
| XLogP | 0.23 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.72 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|