C18H13Cl2NO5 — CID 8660874
[2-(3-chloroanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8660874) has the molecular formula C18H13Cl2NO5 and a molecular weight of 394.21 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8660874 |
| Molecular Formula | C18H13Cl2NO5 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H13Cl2NO5/c19-12-2-1-3-13(8-12)21-16(22)9-24-17(23)5-4-11-6-14(20)18-15(7-11)25-10-26-18/h1-8H,9-10H2,(H,21,22)/b5-4+ |
| InChIKey | BYSCSFBQLHVWJW-SNAWJCMRSA-N |
| XLogP | 3.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|