C17H12ClNO6S — CID 8660845
[2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8660845) has the molecular formula C17H12ClNO6S and a molecular weight of 393.80 g/mol. Its IUPAC name is [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8660845 |
| Molecular Formula | C17H12ClNO6S |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | [2-oxo-2-(thiophene-2-carbonylamino)ethyl] (E)-3-(7-chloro-1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cc(Cl)c2c(c1)OCO2)NC(=O)c1cccs1 |
| InChI | InChI=1S/C17H12ClNO6S/c18-11-6-10(7-12-16(11)25-9-24-12)3-4-15(21)23-8-14(20)19-17(22)13-2-1-5-26-13/h1-7H,8-9H2,(H,19,20,22)/b4-3+ |
| InChIKey | QCGGACUNVJVWAL-ONEGZZNKSA-N |
| XLogP | 2.64 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|