C13H9ClN2O3S — CID 9148154
N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiophene-2-carboxamide (PubChem CID 9148154) has the molecular formula C13H9ClN2O3S and a molecular weight of 308.75 g/mol. Its IUPAC name is N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9148154 |
| Molecular Formula | C13H9ClN2O3S |
| Molecular Weight | 308.75 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | N-[(Z)-(7-chloro-1,3-benzodioxol-5-yl)methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C\c1cc(Cl)c2c(c1)OCO2)c1cccs1 |
| InChI | InChI=1S/C13H9ClN2O3S/c14-9-4-8(5-10-12(9)19-7-18-10)6-15-16-13(17)11-2-1-3-20-11/h1-6H,7H2,(H,16,17)/b15-6- |
| InChIKey | XEMVRZQKJBEQNT-UUASQNMZSA-N |
| XLogP | 2.89 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|