C16H17N3O2S — CID 6906036
N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiophene-2-carboxamide (PubChem CID 6906036) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6906036 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C/c1ccc(N2CCOCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C16H17N3O2S/c20-16(15-2-1-11-22-15)18-17-12-13-3-5-14(6-4-13)19-7-9-21-10-8-19/h1-6,11-12H,7-10H2,(H,18,20)/b17-12+ |
| InChIKey | XITDYUNZAGZCPN-SFQUDFHCSA-N |
| XLogP | 2.35 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|