C12H16N4OS — CID 957717
[(4-morpholin-4-ylphenyl)methylideneamino]thiourea (PubChem CID 957717) has the molecular formula C12H16N4OS and a molecular weight of 264.35 g/mol. Its IUPAC name is [(4-morpholin-4-ylphenyl)methylideneamino]thiourea.
| Compound Name | [(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 957717 |
| Molecular Formula | C12H16N4OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | [(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C12H16N4OS/c13-12(18)15-14-9-10-1-3-11(4-2-10)16-5-7-17-8-6-16/h1-4,9H,5-8H2,(H3,13,15,18) |
| InChIKey | QNXVGQNACGSIOY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|