C20H24N4OS — CID 7930417
1-(2,6-dimethylphenyl)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea (PubChem CID 7930417) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7930417 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
| SMILES | Cc1cccc(C)c1NC(=S)N/N=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H24N4OS/c1-15-4-3-5-16(2)19(15)22-20(26)23-21-14-17-6-8-18(9-7-17)24-10-12-25-13-11-24/h3-9,14H,10-13H2,1-2H3,(H2,22,23,26)/b21-14- |
| InChIKey | WXGCAAPBULEHTL-STZFKDTASA-N |
| XLogP | 3.46 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|