C23H28N6O2S — CID 6905503
1,3-bis[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea (PubChem CID 6905503) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 1,3-bis[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea.
| Compound Name | 1,3-bis[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 6905503 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 1,3-bis[(E)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
| SMILES | S=C(N/N=C/c1ccc(N2CCOCC2)cc1)N/N=C/c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H28N6O2S/c32-23(26-24-17-19-1-5-21(6-2-19)28-9-13-30-14-10-28)27-25-18-20-3-7-22(8-4-20)29-11-15-31-16-12-29/h1-8,17-18H,9-16H2,(H2,26,27,32)/b24-17+,25-18+ |
| InChIKey | JGHPSJVADTZQOZ-WZGDJCGDSA-N |
| XLogP | 2.19 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|