C19H28N4OS — CID 9122070
1-[(1R,2S)-2-methylcyclohexyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea (PubChem CID 9122070) has the molecular formula C19H28N4OS and a molecular weight of 360.53 g/mol. Its IUPAC name is 1-[(1R,2S)-2-methylcyclohexyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9122070 |
| Molecular Formula | C19H28N4OS |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[(1R,2S)-2-methylcyclohexyl]-3-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)N/N=C\c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C19H28N4OS/c1-15-4-2-3-5-18(15)21-19(25)22-20-14-16-6-8-17(9-7-16)23-10-12-24-13-11-23/h6-9,14-15,18H,2-5,10-13H2,1H3,(H2,21,22,25)/b20-14-/t15-,18+/m0/s1 |
| InChIKey | UJKWFZVGXARQQK-KNHIOLBISA-N |
| XLogP | 2.90 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|