C17H24N4OS — CID 9122032
N-[4-[(Z)-[[(1S,2S)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide (PubChem CID 9122032) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[4-[(Z)-[[(1S,2S)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[[(1S,2S)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 9122032 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[4-[(Z)-[[(1S,2S)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=N\NC(=S)N[C@H]2CCCC[C@@H]2C)cc1 |
| InChI | InChI=1S/C17H24N4OS/c1-12-5-3-4-6-16(12)20-17(23)21-18-11-14-7-9-15(10-8-14)19-13(2)22/h7-12,16H,3-6H2,1-2H3,(H,19,22)(H2,20,21,23)/b18-11-/t12-,16-/m0/s1 |
| InChIKey | AURZMWUDFDFLDO-MGHVGWKJSA-N |
| XLogP | 3.02 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|