C15H20FN3S — CID 9122210
1-[(Z)-(3-fluorophenyl)methylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 9122210) has the molecular formula C15H20FN3S and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 9122210 |
| Molecular Formula | C15H20FN3S |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 1-[(Z)-(3-fluorophenyl)methylideneamino]-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@H]1CCCC[C@H]1NC(=S)N/N=C\c1cccc(F)c1 |
| InChI | InChI=1S/C15H20FN3S/c1-11-5-2-3-8-14(11)18-15(20)19-17-10-12-6-4-7-13(16)9-12/h4,6-7,9-11,14H,2-3,5,8H2,1H3,(H2,18,19,20)/b17-10-/t11-,14+/m0/s1 |
| InChIKey | VFIRNFHBQISVAN-ZOZCTLSNSA-N |
| XLogP | 3.20 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|