C16H23N3S — CID 9122245
1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(4-methylphenyl)methylideneamino]thiourea (PubChem CID 9122245) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(4-methylphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(4-methylphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9122245 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-[(1R,2R)-2-methylcyclohexyl]-3-[(Z)-(4-methylphenyl)methylideneamino]thiourea |
| SMILES | Cc1ccc(/C=N\NC(=S)N[C@@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C16H23N3S/c1-12-7-9-14(10-8-12)11-17-19-16(20)18-15-6-4-3-5-13(15)2/h7-11,13,15H,3-6H2,1-2H3,(H2,18,19,20)/b17-11-/t13-,15-/m1/s1 |
| InChIKey | UXVHCWLAEDUNIG-DCFZTUSPSA-N |
| XLogP | 3.37 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|