C13H19N3S2 — CID 9122288
1-[(1S,2S)-2-methylcyclohexyl]-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea (PubChem CID 9122288) has the molecular formula C13H19N3S2 and a molecular weight of 281.45 g/mol. Its IUPAC name is 1-[(1S,2S)-2-methylcyclohexyl]-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea.
| Compound Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 9122288 |
| Molecular Formula | C13H19N3S2 |
| Molecular Weight | 281.45 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 1-[(1S,2S)-2-methylcyclohexyl]-3-[(Z)-thiophen-3-ylmethylideneamino]thiourea |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=S)N/N=C\c1ccsc1 |
| InChI | InChI=1S/C13H19N3S2/c1-10-4-2-3-5-12(10)15-13(17)16-14-8-11-6-7-18-9-11/h6-10,12H,2-5H2,1H3,(H2,15,16,17)/b14-8-/t10-,12-/m0/s1 |
| InChIKey | JWKVLRAQZMBKOM-VOFDWMSLSA-N |
| XLogP | 3.12 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|