C16H20N3O2S- — CID 9122165
4-[(Z)-[[(1S,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]benzoate (PubChem CID 9122165) has the molecular formula C16H20N3O2S- and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[(Z)-[[(1S,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]benzoate.
| Compound Name | 4-[(Z)-[[(1S,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]benzoate |
|---|---|
| PubChem CID | 9122165 |
| Molecular Formula | C16H20N3O2S- |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-[(Z)-[[(1S,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]benzoate |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)N/N=C\c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H21N3O2S/c1-11-4-2-3-5-14(11)18-16(22)19-17-10-12-6-8-13(9-7-12)15(20)21/h6-11,14H,2-5H2,1H3,(H,20,21)(H2,18,19,22)/p-1/b17-10-/t11-,14+/m1/s1 |
| InChIKey | PLPLBSKVVNDOKX-OGWNRBEGSA-M |
| XLogP | 1.43 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|