C19H27N3O4S — CID 9122393
[2,6-dimethoxy-4-[(Z)-[[(1R,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl] acetate (PubChem CID 9122393) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is [2,6-dimethoxy-4-[(Z)-[[(1R,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl] acetate.
| Compound Name | [2,6-dimethoxy-4-[(Z)-[[(1R,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 9122393 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2,6-dimethoxy-4-[(Z)-[[(1R,2R)-2-methylcyclohexyl]carbamothioylhydrazinylidene]methyl]phenyl] acetate |
| SMILES | COc1cc(/C=N\NC(=S)N[C@@H]2CCCC[C@H]2C)cc(OC)c1OC(C)=O |
| InChI | InChI=1S/C19H27N3O4S/c1-12-7-5-6-8-15(12)21-19(27)22-20-11-14-9-16(24-3)18(26-13(2)23)17(10-14)25-4/h9-12,15H,5-8H2,1-4H3,(H2,21,22,27)/b20-11-/t12-,15-/m1/s1 |
| InChIKey | YPUVZWVULFUEHO-LBPKFYEDSA-N |
| XLogP | 3.01 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|