C18H27N3O3S — CID 9122275
1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea (PubChem CID 9122275) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 9122275 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(Z)-(2,4,5-trimethoxyphenyl)methylideneamino]thiourea |
| SMILES | COc1cc(OC)c(OC)cc1/C=N\NC(=S)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C18H27N3O3S/c1-12-7-5-6-8-14(12)20-18(25)21-19-11-13-9-16(23-3)17(24-4)10-15(13)22-2/h9-12,14H,5-8H2,1-4H3,(H2,20,21,25)/b19-11-/t12-,14+/m1/s1 |
| InChIKey | FKLKEZRZNQCCHM-GVWOJQLTSA-N |
| XLogP | 3.09 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|