C17H26N2O2S — CID 8660196
1-(4,5-dimethoxy-2-methylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea (PubChem CID 8660196) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8660196 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)-3-[(1R,2S)-2-methylcyclohexyl]thiourea |
| SMILES | COc1cc(C)c(NC(=S)N[C@@H]2CCCC[C@@H]2C)cc1OC |
| InChI | InChI=1S/C17H26N2O2S/c1-11-7-5-6-8-13(11)18-17(22)19-14-10-16(21-4)15(20-3)9-12(14)2/h9-11,13H,5-8H2,1-4H3,(H2,18,19,22)/t11-,13+/m0/s1 |
| InChIKey | YDPZEFCFEPWWFT-WCQYABFASA-N |
| XLogP | 3.88 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|