C15H21N3O2S — CID 8620245
1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-5-nitrophenyl)thiourea (PubChem CID 8620245) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-5-nitrophenyl)thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-5-nitrophenyl)thiourea |
|---|---|
| PubChem CID | 8620245 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(2-methyl-5-nitrophenyl)thiourea |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=S)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C15H21N3O2S/c1-10-5-3-4-6-13(10)16-15(21)17-14-9-12(18(19)20)8-7-11(14)2/h7-10,13H,3-6H2,1-2H3,(H2,16,17,21)/t10-,13+/m1/s1 |
| InChIKey | YUVOQVZBUPCSGJ-MFKMUULPSA-N |
| XLogP | 3.77 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|