C16H22ClN5O2S2 — CID 11933374
1-(2-chloro-5-nitrophenyl)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamothioylamino]thiourea (PubChem CID 11933374) has the molecular formula C16H22ClN5O2S2 and a molecular weight of 415.97 g/mol. Its IUPAC name is 1-(2-chloro-5-nitrophenyl)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamothioylamino]thiourea.
| Compound Name | 1-(2-chloro-5-nitrophenyl)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamothioylamino]thiourea |
|---|---|
| PubChem CID | 11933374 |
| Molecular Formula | C16H22ClN5O2S2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 1-(2-chloro-5-nitrophenyl)-3-[[(1S,2R,3R)-2,3-dimethylcyclohexyl]carbamothioylamino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=S)Nc1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C16H22ClN5O2S2/c1-9-4-3-5-13(10(9)2)18-15(25)20-21-16(26)19-14-8-11(22(23)24)6-7-12(14)17/h6-10,13H,3-5H2,1-2H3,(H2,18,20,25)(H2,19,21,26)/t9-,10-,13+/m1/s1 |
| InChIKey | LTIFSULNXIMTFE-BREBYQMCSA-N |
| XLogP | 3.74 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|