C16H22N4O3S — CID 11946097
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(4-nitrobenzoyl)amino]thiourea (PubChem CID 11946097) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(4-nitrobenzoyl)amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(4-nitrobenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 11946097 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(4-nitrobenzoyl)amino]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@@H]1NC(=S)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H22N4O3S/c1-10-4-3-5-14(11(10)2)17-16(24)19-18-15(21)12-6-8-13(9-7-12)20(22)23/h6-11,14H,3-5H2,1-2H3,(H,18,21)(H2,17,19,24)/t10-,11-,14+/m1/s1 |
| InChIKey | ZLSVACGQOQXNEJ-GYSYKLTISA-N |
| XLogP | 2.53 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|