C19H27N5O3S — CID 11943679
1-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11943679) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is 1-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11943679 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | 1-[[4-(cyclopropylamino)-3-nitrobenzoyl]amino]-3-[(1R,2R,3R)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=S)NNC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H27N5O3S/c1-11-4-3-5-15(12(11)2)21-19(28)23-22-18(25)13-6-9-16(20-14-7-8-14)17(10-13)24(26)27/h6,9-12,14-15,20H,3-5,7-8H2,1-2H3,(H,22,25)(H2,21,23,28)/t11-,12-,15-/m1/s1 |
| InChIKey | KCYSJRAMRSYVMV-LALPHHSUSA-N |
| XLogP | 3.10 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|