C16H22N4O3 — CID 31098173
4-(cyclopropylamino)-N-(1-methylpiperidin-4-yl)-3-nitrobenzamide (PubChem CID 31098173) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-(1-methylpiperidin-4-yl)-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-(1-methylpiperidin-4-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 31098173 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-(cyclopropylamino)-N-(1-methylpiperidin-4-yl)-3-nitrobenzamide |
| SMILES | CN1CCC(NC(=O)c2ccc(NC3CC3)c([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C16H22N4O3/c1-19-8-6-13(7-9-19)18-16(21)11-2-5-14(17-12-3-4-12)15(10-11)20(22)23/h2,5,10,12-13,17H,3-4,6-9H2,1H3,(H,18,21) |
| InChIKey | RAOXTUOUPCDSJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|