C19H28N4O3 — CID 27032497
N-[3-(azepan-1-yl)propyl]-4-(cyclopropylamino)-3-nitrobenzamide (PubChem CID 27032497) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-[3-(azepan-1-yl)propyl]-4-(cyclopropylamino)-3-nitrobenzamide.
| Compound Name | N-[3-(azepan-1-yl)propyl]-4-(cyclopropylamino)-3-nitrobenzamide |
|---|---|
| PubChem CID | 27032497 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | N-[3-(azepan-1-yl)propyl]-4-(cyclopropylamino)-3-nitrobenzamide |
| SMILES | O=C(NCCCN1CCCCCC1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H28N4O3/c24-19(20-10-5-13-22-11-3-1-2-4-12-22)15-6-9-17(21-16-7-8-16)18(14-15)23(25)26/h6,9,14,16,21H,1-5,7-8,10-13H2,(H,20,24) |
| InChIKey | UDICZEHENAKOTR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|