C17H23N3O4 — CID 111485738
4-(cyclopropylamino)-N-[(1-hydroxycyclohexyl)methyl]-3-nitrobenzamide (PubChem CID 111485738) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is 4-(cyclopropylamino)-N-[(1-hydroxycyclohexyl)methyl]-3-nitrobenzamide.
| Compound Name | 4-(cyclopropylamino)-N-[(1-hydroxycyclohexyl)methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 111485738 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 4-(cyclopropylamino)-N-[(1-hydroxycyclohexyl)methyl]-3-nitrobenzamide |
| SMILES | O=C(NCC1(O)CCCCC1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H23N3O4/c21-16(18-11-17(22)8-2-1-3-9-17)12-4-7-14(19-13-5-6-13)15(10-12)20(23)24/h4,7,10,13,19,22H,1-3,5-6,8-9,11H2,(H,18,21) |
| InChIKey | BQBGYYQYFVNFSF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|